C16H12N4O — CID 78914172
N-(4-cyano-1H-pyrazol-5-yl)-2-naphthalen-1-ylacetamide (PubChem CID 78914172) has the molecular formula C16H12N4O and a molecular weight of 276.30 g/mol. Its IUPAC name is N-(4-cyano-1H-pyrazol-5-yl)-2-naphthalen-1-ylacetamide.
| Compound Name | N-(4-cyano-1H-pyrazol-5-yl)-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 78914172 |
| Molecular Formula | C16H12N4O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | N-(4-cyano-1H-pyrazol-5-yl)-2-naphthalen-1-ylacetamide |
| SMILES | N#Cc1cn[nH]c1NC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C16H12N4O/c17-9-13-10-18-20-16(13)19-15(21)8-12-6-3-5-11-4-1-2-7-14(11)12/h1-7,10H,8H2,(H2,18,19,20,21) |
| InChIKey | RWEVPCDYMMMBEQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |