About (6R)-6-(2-methylpropyl)-4,7-diazaspiro[2.5]octane
(6R)-6-(2-methylpropyl)-4,7-diazaspiro[2.5]octane (PubChem CID 70228754) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is (6R)-6-(2-methylpropyl)-4,7-diazaspiro[2.5]octane.
Molecular Properties
| Compound Name | (6R)-6-(2-methylpropyl)-4,7-diazaspiro[2.5]octane |
| PubChem CID | 70228754 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (6R)-6-(2-methylpropyl)-4,7-diazaspiro[2.5]octane |
| SMILES | CC(C)C[C@@H]1CNC2(CC2)CN1 |
| InChI | InChI=1S/C10H20N2/c1-8(2)5-9-6-12-10(3-4-10)7-11-9/h8-9,11-12H,3-7H2,1-2H3/t9-/m1/s1 |
| InChIKey | XAJHRAHTFGYJEP-SECBINFHSA-N |
| XLogP | 1.13 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6R)-6-(2-methylpropyl)-4,7-diazaspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-(2-methylpropyl)-4,7-diazaspiro[2.5]octane?
The IUPAC name of (6R)-6-(2-methylpropyl)-4,7-diazaspiro[2.5]octane (CID 70228754) is (6R)-6-(2-methylpropyl)-4,7-diazaspiro[2.5]octane.
What is the SMILES notation for (6R)-6-(2-methylpropyl)-4,7-diazaspiro[2.5]octane?
The canonical SMILES for (6R)-6-(2-methylpropyl)-4,7-diazaspiro[2.5]octane is CC(C)C[C@@H]1CNC2(CC2)CN1.
What is the InChIKey of (6R)-6-(2-methylpropyl)-4,7-diazaspiro[2.5]octane?
The InChIKey is XAJHRAHTFGYJEP-SECBINFHSA-N. The full InChI is InChI=1S/C10H20N2/c1-8(2)5-9-6-12-10(3-4-10)7-11-9/h8-9,11-12H,3-7H2,1-2H3/t9-/m1/s1.
What are the key properties of (6R)-6-(2-methylpropyl)-4,7-diazaspiro[2.5]octane?
(6R)-6-(2-methylpropyl)-4,7-diazaspiro[2.5]octane has a molecular weight of 168.28 g/mol, XLogP of 1.13, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-(2-methylpropyl)-4,7-diazaspiro[2.5]octane is sourced from PubChem (CID 70228754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).