C12H16N2O6 — CID 70229444
4-[(2S)-2-amino-2-carboxyethyl]-3-pent-2-enoxy-1,2-oxazole-5-carboxylic acid (PubChem CID 70229444) has the molecular formula C12H16N2O6 and a molecular weight of 284.27 g/mol. Its IUPAC name is 4-[(2S)-2-amino-2-carboxyethyl]-3-pent-2-enoxy-1,2-oxazole-5-carboxylic acid.
| Compound Name | 4-[(2S)-2-amino-2-carboxyethyl]-3-pent-2-enoxy-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 70229444 |
| Molecular Formula | C12H16N2O6 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 4-[(2S)-2-amino-2-carboxyethyl]-3-pent-2-enoxy-1,2-oxazole-5-carboxylic acid |
| SMILES | CCC=CCOc1noc(C(=O)O)c1C[C@H](N)C(=O)O |
| InChI | InChI=1S/C12H16N2O6/c1-2-3-4-5-19-10-7(6-8(13)11(15)16)9(12(17)18)20-14-10/h3-4,8H,2,5-6,13H2,1H3,(H,15,16)(H,17,18)/t8-/m0/s1 |
| InChIKey | ZHSRJRDWGXMUCU-QMMMGPOBSA-N |
| XLogP | 0.67 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|