C15H23NO3 — CID 145410713
2-amino-3-phenylpropanoic acid;formaldehyde;pent-1-ene (PubChem CID 145410713) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 2-amino-3-phenylpropanoic acid;formaldehyde;pent-1-ene.
| Compound Name | 2-amino-3-phenylpropanoic acid;formaldehyde;pent-1-ene |
|---|---|
| PubChem CID | 145410713 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 2-amino-3-phenylpropanoic acid;formaldehyde;pent-1-ene |
| SMILES | C=CCCC.C=O.NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C9H11NO2.C5H10.CH2O/c10-8(9(11)12)6-7-4-2-1-3-5-7;1-3-5-4-2;1-2/h1-5,8H,6,10H2,(H,11,12);3H,1,4-5H2,2H3;1H2 |
| InChIKey | NNXRZZCMSNMSOY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|