About methyl 7-cyano-4H-pyrrolo[1,2-a]benzimidazole-6-carboxylate
methyl 7-cyano-4H-pyrrolo[1,2-a]benzimidazole-6-carboxylate (PubChem CID 70229624) has the molecular formula C13H9N3O2
and a molecular weight of 239.23 g/mol. Its IUPAC name is methyl 7-cyano-4H-pyrrolo[1,2-a]benzimidazole-6-carboxylate.
Analyze methyl 7-cyano-4H-pyrrolo[1,2-a]benzimidazole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-cyano-4H-pyrrolo[1,2-a]benzimidazole-6-carboxylate?
The IUPAC name of methyl 7-cyano-4H-pyrrolo[1,2-a]benzimidazole-6-carboxylate (CID 70229624) is methyl 7-cyano-4H-pyrrolo[1,2-a]benzimidazole-6-carboxylate.
What is the SMILES notation for methyl 7-cyano-4H-pyrrolo[1,2-a]benzimidazole-6-carboxylate?
The canonical SMILES for methyl 7-cyano-4H-pyrrolo[1,2-a]benzimidazole-6-carboxylate is COC(=O)c1cc2[nH]c3cccn3c2cc1C#N.
What is the InChIKey of methyl 7-cyano-4H-pyrrolo[1,2-a]benzimidazole-6-carboxylate?
The InChIKey is FFKVXIGSSWGUHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O2/c1-18-13(17)9-6-10-11(5-8(9)7-14)16-4-2-3-12(16)15-10/h2-6,15H,1H3.
What are the key properties of methyl 7-cyano-4H-pyrrolo[1,2-a]benzimidazole-6-carboxylate?
methyl 7-cyano-4H-pyrrolo[1,2-a]benzimidazole-6-carboxylate has a molecular weight of 239.23 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-cyano-4H-pyrrolo[1,2-a]benzimidazole-6-carboxylate is sourced from PubChem (CID 70229624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).