C25H34N2O3 — CID 70230799
1-[(2R)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)decan-3-yl]-3-phenylurea (PubChem CID 70230799) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is 1-[(2R)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)decan-3-yl]-3-phenylurea.
| Compound Name | 1-[(2R)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)decan-3-yl]-3-phenylurea |
|---|---|
| PubChem CID | 70230799 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 1-[(2R)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)decan-3-yl]-3-phenylurea |
| SMILES | CCCCCCCC(NC(=O)Nc1ccccc1)[C@H](C)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C25H34N2O3/c1-3-4-5-6-10-13-22(27-25(28)26-21-11-8-7-9-12-21)19(2)20-14-15-23-24(18-20)30-17-16-29-23/h7-9,11-12,14-15,18-19,22H,3-6,10,13,16-17H2,1-2H3,(H2,26,27,28)/t19-,22?/m1/s1 |
| InChIKey | UMFXEHHIUTXHFN-LCQOSCCDSA-N |
| XLogP | 6.11 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|