C47H42O14 — CID 70231253
2-[[3,5-dimethoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-tribenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]oxyphenyl]methylidene]butanoic acid (PubChem CID 70231253) has the molecular formula C47H42O14 and a molecular weight of 830.84 g/mol. Its IUPAC name is 2-[[3,5-dimethoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-tribenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]oxyphenyl]methylidene]butanoic acid.
| Compound Name | 2-[[3,5-dimethoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-tribenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]oxyphenyl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 70231253 |
| Molecular Formula | C47H42O14 |
| Molecular Weight | 830.84 g/mol |
| Exact Mass | 830.26 |
| IUPAC Name | 2-[[3,5-dimethoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-tribenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]oxyphenyl]methylidene]butanoic acid |
| SMILES | CCC(=Cc1cc(OC)c(O[C@@H]2O[C@H](COC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)c(OC)c1)C(=O)O |
| InChI | InChI=1S/C47H42O14/c1-4-30(42(48)49)25-29-26-35(54-2)38(36(27-29)55-3)61-47-41(60-46(53)34-23-15-8-16-24-34)40(59-45(52)33-21-13-7-14-22-33)39(58-44(51)32-19-11-6-12-20-32)37(57-47)28-56-43(50)31-17-9-5-10-18-31/h5-27,37,39-41,47H,4,28H2,1-3H3,(H,48,49)/t37-,39+,40+,41-,47+/m1/s1 |
| InChIKey | UIFKRJCFUHZESQ-HGMUWNIZSA-N |
| XLogP | 7.22 |
| TPSA | 179.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.84 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|