C28H31N5O5 — CID 70232439
2-[(4S)-4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]-N,N-dipropyl-1-benzofuran-5-carboximidamide (PubChem CID 70232439) has the molecular formula C28H31N5O5 and a molecular weight of 517.59 g/mol. Its IUPAC name is 2-[(4S)-4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]-N,N-dipropyl-1-benzofuran-5-carboximidamide.
| Compound Name | 2-[(4S)-4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]-N,N-dipropyl-1-benzofuran-5-carboximidamide |
|---|---|
| PubChem CID | 70232439 |
| Molecular Formula | C28H31N5O5 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | 2-[(4S)-4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]-N,N-dipropyl-1-benzofuran-5-carboximidamide |
| SMILES | [H]/N=C(/c1ccc2oc([C@]3(CN4Cc5ccc(OC)cc5C4=O)NC(=O)NC3=O)cc2c1)N(CCC)CCC |
| InChI | InChI=1S/C28H31N5O5/c1-4-10-32(11-5-2)24(29)17-7-9-22-19(12-17)13-23(38-22)28(26(35)30-27(36)31-28)16-33-15-18-6-8-20(37-3)14-21(18)25(33)34/h6-9,12-14,29H,4-5,10-11,15-16H2,1-3H3,(H2,30,31,35,36)/b29-24-/t28-/m0/s1 |
| InChIKey | WELWHZSJNONUPL-VEVGFDJISA-N |
| XLogP | 3.58 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|