C30H26O11 — CID 70232989
(2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one;3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one (PubChem CID 70232989) has the molecular formula C30H26O11 and a molecular weight of 562.53 g/mol. Its IUPAC name is (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one;3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one.
| Compound Name | (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one;3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 70232989 |
| Molecular Formula | C30H26O11 |
| Molecular Weight | 562.53 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one;3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one |
| SMILES | O=C(CCc1ccc(O)cc1)c1c(O)cc(O)cc1O.O=C1C[C@@H](c2ccc(O)c(O)c2)Oc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C15H12O6.C15H14O5/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7;16-10-4-1-9(2-5-10)3-6-12(18)15-13(19)7-11(17)8-14(15)20/h1-5,13,16-19H,6H2;1-2,4-5,7-8,16-17,19-20H,3,6H2/t13-;/m0./s1 |
| InChIKey | YHVSVHUYBWCMFS-ZOWNYOTGSA-N |
| XLogP | 4.54 |
| TPSA | 205.21 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|