C15H28N2O3 — CID 70234735
N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2,3,4,5,6,7-hexahydro-1H-isoindol-5-amine (PubChem CID 70234735) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2,3,4,5,6,7-hexahydro-1H-isoindol-5-amine.
| Compound Name | N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2,3,4,5,6,7-hexahydro-1H-isoindol-5-amine |
|---|---|
| PubChem CID | 70234735 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2,3,4,5,6,7-hexahydro-1H-isoindol-5-amine |
| SMILES | COCCOCCOCCNC1CCC2=C(CNC2)C1 |
| InChI | InChI=1S/C15H28N2O3/c1-18-6-7-20-9-8-19-5-4-17-15-3-2-13-11-16-12-14(13)10-15/h15-17H,2-12H2,1H3 |
| InChIKey | RKZWZWMJIKIQNY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|