About 5-chloro-1,2-dihydropyrimidine-2-carboxylic acid
5-chloro-1,2-dihydropyrimidine-2-carboxylic acid (PubChem CID 70234858) has the molecular formula C5H5ClN2O2
and a molecular weight of 160.56 g/mol. Its IUPAC name is 5-chloro-1,2-dihydropyrimidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-chloro-1,2-dihydropyrimidine-2-carboxylic acid |
| PubChem CID | 70234858 |
| Molecular Formula | C5H5ClN2O2 |
| Molecular Weight | 160.56 g/mol |
| Exact Mass | 160.00 |
| IUPAC Name | 5-chloro-1,2-dihydropyrimidine-2-carboxylic acid |
| SMILES | O=C(O)C1N=CC(Cl)=CN1 |
| InChI | InChI=1S/C5H5ClN2O2/c6-3-1-7-4(5(9)10)8-2-3/h1-2,4,7H,(H,9,10) |
| InChIKey | NSORYYVXWRTEKE-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.56 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-1,2-dihydropyrimidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,2-dihydropyrimidine-2-carboxylic acid?
The IUPAC name of 5-chloro-1,2-dihydropyrimidine-2-carboxylic acid (CID 70234858) is 5-chloro-1,2-dihydropyrimidine-2-carboxylic acid.
What is the SMILES notation for 5-chloro-1,2-dihydropyrimidine-2-carboxylic acid?
The canonical SMILES for 5-chloro-1,2-dihydropyrimidine-2-carboxylic acid is O=C(O)C1N=CC(Cl)=CN1.
What is the InChIKey of 5-chloro-1,2-dihydropyrimidine-2-carboxylic acid?
The InChIKey is NSORYYVXWRTEKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5ClN2O2/c6-3-1-7-4(5(9)10)8-2-3/h1-2,4,7H,(H,9,10).
What are the key properties of 5-chloro-1,2-dihydropyrimidine-2-carboxylic acid?
5-chloro-1,2-dihydropyrimidine-2-carboxylic acid has a molecular weight of 160.56 g/mol, XLogP of 0.15, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,2-dihydropyrimidine-2-carboxylic acid is sourced from PubChem (CID 70234858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).