C6H6ClNO — CID 70235076
4-chloro-2-prop-2-enyl-1,3-oxazole (PubChem CID 70235076) has the molecular formula C6H6ClNO and a molecular weight of 143.57 g/mol. Its IUPAC name is 4-chloro-2-prop-2-enyl-1,3-oxazole.
| Compound Name | 4-chloro-2-prop-2-enyl-1,3-oxazole |
|---|---|
| PubChem CID | 70235076 |
| Molecular Formula | C6H6ClNO |
| Molecular Weight | 143.57 g/mol |
| Exact Mass | 143.01 |
| IUPAC Name | 4-chloro-2-prop-2-enyl-1,3-oxazole |
| SMILES | C=CCc1nc(Cl)co1 |
| InChI | InChI=1S/C6H6ClNO/c1-2-3-6-8-5(7)4-9-6/h2,4H,1,3H2 |
| InChIKey | AAPBSDZZWDSCBD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.57 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|