C28H31Cl2F2N5O2 — CID 70236781
(2R,3S,4R,5S)-4-amino-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)-N-[5-(2-hydroxyethyl)pyrazin-2-yl]pyrrolidine-2-carboxamide (PubChem CID 70236781) has the molecular formula C28H31Cl2F2N5O2 and a molecular weight of 578.49 g/mol. Its IUPAC name is (2R,3S,4R,5S)-4-amino-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)-N-[5-(2-hydroxyethyl)pyrazin-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4R,5S)-4-amino-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)-N-[5-(2-hydroxyethyl)pyrazin-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70236781 |
| Molecular Formula | C28H31Cl2F2N5O2 |
| Molecular Weight | 578.49 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | (2R,3S,4R,5S)-4-amino-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)-N-[5-(2-hydroxyethyl)pyrazin-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)Nc2cnc(CCO)cn2)[C@H](c2cccc(Cl)c2F)[C@@]1(N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C28H31Cl2F2N5O2/c1-27(2,3)12-21-28(33,18-8-7-15(29)11-20(18)31)23(17-5-4-6-19(30)24(17)32)25(36-21)26(39)37-22-14-34-16(9-10-38)13-35-22/h4-8,11,13-14,21,23,25,36,38H,9-10,12,33H2,1-3H3,(H,35,37,39)/t21-,23-,25+,28+/m0/s1 |
| InChIKey | CZPMUTJSSDPVLM-GUAPPOABSA-N |
| XLogP | 4.95 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |