C33H38N2O7 — CID 70237299
ethanol;2-[[2-methoxy-4-[[2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]indol-1-yl]methyl]phenyl]methoxy]-2-oxoacetic acid (PubChem CID 70237299) has the molecular formula C33H38N2O7 and a molecular weight of 574.67 g/mol. Its IUPAC name is ethanol;2-[[2-methoxy-4-[[2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]indol-1-yl]methyl]phenyl]methoxy]-2-oxoacetic acid.
| Compound Name | ethanol;2-[[2-methoxy-4-[[2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]indol-1-yl]methyl]phenyl]methoxy]-2-oxoacetic acid |
|---|---|
| PubChem CID | 70237299 |
| Molecular Formula | C33H38N2O7 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | ethanol;2-[[2-methoxy-4-[[2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]indol-1-yl]methyl]phenyl]methoxy]-2-oxoacetic acid |
| SMILES | CCO.COc1cc(Cn2c(-c3ccc(OCCN4CCCC4)cc3)cc3ccccc32)ccc1COC(=O)C(=O)O |
| InChI | InChI=1S/C31H32N2O6.C2H6O/c1-37-29-18-22(8-9-25(29)21-39-31(36)30(34)35)20-33-27-7-3-2-6-24(27)19-28(33)23-10-12-26(13-11-23)38-17-16-32-14-4-5-15-32;1-2-3/h2-3,6-13,18-19H,4-5,14-17,20-21H2,1H3,(H,34,35);3H,2H2,1H3 |
| InChIKey | YJBULULIYTZNMZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|