C18H18N2O4 — CID 70237355
3-(4-carboxycyclohexyl)-2-pyridin-2-ylpyridine-4-carboxylic acid (PubChem CID 70237355) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 3-(4-carboxycyclohexyl)-2-pyridin-2-ylpyridine-4-carboxylic acid.
| Compound Name | 3-(4-carboxycyclohexyl)-2-pyridin-2-ylpyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 70237355 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 3-(4-carboxycyclohexyl)-2-pyridin-2-ylpyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(-c2ccccn2)c1C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C18H18N2O4/c21-17(22)12-6-4-11(5-7-12)15-13(18(23)24)8-10-20-16(15)14-3-1-2-9-19-14/h1-3,8-12H,4-7H2,(H,21,22)(H,23,24) |
| InChIKey | PARSIRUQMVERFY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |