C23H24O4S2 — CID 70237466
ethyl 3-[4-[2-(5,9-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraen-7-yl)ethoxy]phenyl]-2-methoxypropanoate (PubChem CID 70237466) has the molecular formula C23H24O4S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is ethyl 3-[4-[2-(5,9-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraen-7-yl)ethoxy]phenyl]-2-methoxypropanoate.
| Compound Name | ethyl 3-[4-[2-(5,9-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraen-7-yl)ethoxy]phenyl]-2-methoxypropanoate |
|---|---|
| PubChem CID | 70237466 |
| Molecular Formula | C23H24O4S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | ethyl 3-[4-[2-(5,9-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraen-7-yl)ethoxy]phenyl]-2-methoxypropanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OCCC2c3sccc3-c3ccsc32)cc1)OC |
| InChI | InChI=1S/C23H24O4S2/c1-3-26-23(24)20(25-2)14-15-4-6-16(7-5-15)27-11-8-19-21-17(9-12-28-21)18-10-13-29-22(18)19/h4-7,9-10,12-13,19-20H,3,8,11,14H2,1-2H3 |
| InChIKey | BNPKQCMTYDJMHY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |