C17H24O5 — CID 69423378
ethyl (2R)-3-[4-(2-hydroxycyclopentyl)oxyphenyl]-2-methoxypropanoate (PubChem CID 69423378) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is ethyl (2R)-3-[4-(2-hydroxycyclopentyl)oxyphenyl]-2-methoxypropanoate.
| Compound Name | ethyl (2R)-3-[4-(2-hydroxycyclopentyl)oxyphenyl]-2-methoxypropanoate |
|---|---|
| PubChem CID | 69423378 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | ethyl (2R)-3-[4-(2-hydroxycyclopentyl)oxyphenyl]-2-methoxypropanoate |
| SMILES | CCOC(=O)[C@@H](Cc1ccc(OC2CCCC2O)cc1)OC |
| InChI | InChI=1S/C17H24O5/c1-3-21-17(19)16(20-2)11-12-7-9-13(10-8-12)22-15-6-4-5-14(15)18/h7-10,14-16,18H,3-6,11H2,1-2H3/t14?,15?,16-/m1/s1 |
| InChIKey | RKGLVDFUMFZIMM-UYSNPLJNSA-N |
| XLogP | 2.10 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |