C26H35BrN2 — CID 70241565
acetonitrile;N-benzyl-3-[4-(3-bromocyclopentyl)phenyl]-N-propylpropan-1-amine (PubChem CID 70241565) has the molecular formula C26H35BrN2 and a molecular weight of 455.48 g/mol. Its IUPAC name is acetonitrile;N-benzyl-3-[4-(3-bromocyclopentyl)phenyl]-N-propylpropan-1-amine.
| Compound Name | acetonitrile;N-benzyl-3-[4-(3-bromocyclopentyl)phenyl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 70241565 |
| Molecular Formula | C26H35BrN2 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | acetonitrile;N-benzyl-3-[4-(3-bromocyclopentyl)phenyl]-N-propylpropan-1-amine |
| SMILES | CC#N.CCCN(CCCc1ccc(C2CCC(Br)C2)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H32BrN.C2H3N/c1-2-16-26(19-21-7-4-3-5-8-21)17-6-9-20-10-12-22(13-11-20)23-14-15-24(25)18-23;1-2-3/h3-5,7-8,10-13,23-24H,2,6,9,14-19H2,1H3;1H3 |
| InChIKey | TYOJRACAKAAZNO-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|