C26H33F3N2 — CID 70244167
acetonitrile;N-benzyl-N-methyl-4-[4-[3-(trifluoromethyl)cyclopentyl]phenyl]butan-2-amine (PubChem CID 70244167) has the molecular formula C26H33F3N2 and a molecular weight of 430.56 g/mol. Its IUPAC name is acetonitrile;N-benzyl-N-methyl-4-[4-[3-(trifluoromethyl)cyclopentyl]phenyl]butan-2-amine.
| Compound Name | acetonitrile;N-benzyl-N-methyl-4-[4-[3-(trifluoromethyl)cyclopentyl]phenyl]butan-2-amine |
|---|---|
| PubChem CID | 70244167 |
| Molecular Formula | C26H33F3N2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | acetonitrile;N-benzyl-N-methyl-4-[4-[3-(trifluoromethyl)cyclopentyl]phenyl]butan-2-amine |
| SMILES | CC#N.CC(CCc1ccc(C2CCC(C(F)(F)F)C2)cc1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C24H30F3N.C2H3N/c1-18(28(2)17-20-6-4-3-5-7-20)8-9-19-10-12-21(13-11-19)22-14-15-23(16-22)24(25,26)27;1-2-3/h3-7,10-13,18,22-23H,8-9,14-17H2,1-2H3;1H3 |
| InChIKey | SPSRFYDDCVAUMD-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |