C22H27Cl2N — CID 70241563
N-benzyl-4-[4-(2,3-dichlorocyclobutyl)phenyl]-N-methylbutan-2-amine (PubChem CID 70241563) has the molecular formula C22H27Cl2N and a molecular weight of 376.37 g/mol. Its IUPAC name is N-benzyl-4-[4-(2,3-dichlorocyclobutyl)phenyl]-N-methylbutan-2-amine.
| Compound Name | N-benzyl-4-[4-(2,3-dichlorocyclobutyl)phenyl]-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 70241563 |
| Molecular Formula | C22H27Cl2N |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-benzyl-4-[4-(2,3-dichlorocyclobutyl)phenyl]-N-methylbutan-2-amine |
| SMILES | CC(CCc1ccc(C2CC(Cl)C2Cl)cc1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C22H27Cl2N/c1-16(25(2)15-18-6-4-3-5-7-18)8-9-17-10-12-19(13-11-17)20-14-21(23)22(20)24/h3-7,10-13,16,20-22H,8-9,14-15H2,1-2H3 |
| InChIKey | FAYDBMHOMBEOBJ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|