C27H36Cl2N2 — CID 70238961
acetonitrile;4-[4-(2,3-dichlorocyclobutyl)phenyl]-N-(2-phenylethyl)-N-propan-2-ylbutan-2-amine (PubChem CID 70238961) has the molecular formula C27H36Cl2N2 and a molecular weight of 459.51 g/mol. Its IUPAC name is acetonitrile;4-[4-(2,3-dichlorocyclobutyl)phenyl]-N-(2-phenylethyl)-N-propan-2-ylbutan-2-amine.
| Compound Name | acetonitrile;4-[4-(2,3-dichlorocyclobutyl)phenyl]-N-(2-phenylethyl)-N-propan-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 70238961 |
| Molecular Formula | C27H36Cl2N2 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | acetonitrile;4-[4-(2,3-dichlorocyclobutyl)phenyl]-N-(2-phenylethyl)-N-propan-2-ylbutan-2-amine |
| SMILES | CC#N.CC(C)N(CCc1ccccc1)C(C)CCc1ccc(C2CC(Cl)C2Cl)cc1 |
| InChI | InChI=1S/C25H33Cl2N.C2H3N/c1-18(2)28(16-15-20-7-5-4-6-8-20)19(3)9-10-21-11-13-22(14-12-21)23-17-24(26)25(23)27;1-2-3/h4-8,11-14,18-19,23-25H,9-10,15-17H2,1-3H3;1H3 |
| InChIKey | XJOHIUKMENVWRG-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|