C25H33FN2 — CID 70243066
acetonitrile;N-benzyl-4-[4-(2-fluorocyclopropyl)phenyl]-N-propan-2-ylbutan-2-amine (PubChem CID 70243066) has the molecular formula C25H33FN2 and a molecular weight of 380.55 g/mol. Its IUPAC name is acetonitrile;N-benzyl-4-[4-(2-fluorocyclopropyl)phenyl]-N-propan-2-ylbutan-2-amine.
| Compound Name | acetonitrile;N-benzyl-4-[4-(2-fluorocyclopropyl)phenyl]-N-propan-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 70243066 |
| Molecular Formula | C25H33FN2 |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | acetonitrile;N-benzyl-4-[4-(2-fluorocyclopropyl)phenyl]-N-propan-2-ylbutan-2-amine |
| SMILES | CC#N.CC(C)N(Cc1ccccc1)C(C)CCc1ccc(C2CC2F)cc1 |
| InChI | InChI=1S/C23H30FN.C2H3N/c1-17(2)25(16-20-7-5-4-6-8-20)18(3)9-10-19-11-13-21(14-12-19)22-15-23(22)24;1-2-3/h4-8,11-14,17-18,22-23H,9-10,15-16H2,1-3H3;1H3 |
| InChIKey | CBTUXIUKKKDPFM-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |