C26H36FN — CID 70242616
N-benzyl-4-[4-(4-fluorocyclohexyl)phenyl]-N-propan-2-ylbutan-2-amine (PubChem CID 70242616) has the molecular formula C26H36FN and a molecular weight of 381.58 g/mol. Its IUPAC name is N-benzyl-4-[4-(4-fluorocyclohexyl)phenyl]-N-propan-2-ylbutan-2-amine.
| Compound Name | N-benzyl-4-[4-(4-fluorocyclohexyl)phenyl]-N-propan-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 70242616 |
| Molecular Formula | C26H36FN |
| Molecular Weight | 381.58 g/mol |
| Exact Mass | 381.28 |
| IUPAC Name | N-benzyl-4-[4-(4-fluorocyclohexyl)phenyl]-N-propan-2-ylbutan-2-amine |
| SMILES | CC(C)N(Cc1ccccc1)C(C)CCc1ccc(C2CCC(F)CC2)cc1 |
| InChI | InChI=1S/C26H36FN/c1-20(2)28(19-23-7-5-4-6-8-23)21(3)9-10-22-11-13-24(14-12-22)25-15-17-26(27)18-16-25/h4-8,11-14,20-21,25-26H,9-10,15-19H2,1-3H3 |
| InChIKey | LERUKVHFSARDKP-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.58 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |