C27H36F3N — CID 70241839
N-(2-phenylethyl)-N-propan-2-yl-4-[4-[2-(trifluoromethyl)cyclopentyl]phenyl]butan-2-amine (PubChem CID 70241839) has the molecular formula C27H36F3N and a molecular weight of 431.59 g/mol. Its IUPAC name is N-(2-phenylethyl)-N-propan-2-yl-4-[4-[2-(trifluoromethyl)cyclopentyl]phenyl]butan-2-amine.
| Compound Name | N-(2-phenylethyl)-N-propan-2-yl-4-[4-[2-(trifluoromethyl)cyclopentyl]phenyl]butan-2-amine |
|---|---|
| PubChem CID | 70241839 |
| Molecular Formula | C27H36F3N |
| Molecular Weight | 431.59 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | N-(2-phenylethyl)-N-propan-2-yl-4-[4-[2-(trifluoromethyl)cyclopentyl]phenyl]butan-2-amine |
| SMILES | CC(C)N(CCc1ccccc1)C(C)CCc1ccc(C2CCCC2C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H36F3N/c1-20(2)31(19-18-22-8-5-4-6-9-22)21(3)12-13-23-14-16-24(17-15-23)25-10-7-11-26(25)27(28,29)30/h4-6,8-9,14-17,20-21,25-26H,7,10-13,18-19H2,1-3H3 |
| InChIKey | JYYHRIVDRNUUON-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.59 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |