C28H38F3N — CID 70244106
N-(2-phenylethyl)-N-propan-2-yl-1-[4-[2-(trifluoromethyl)cyclopentyl]phenyl]pentan-3-amine (PubChem CID 70244106) has the molecular formula C28H38F3N and a molecular weight of 445.61 g/mol. Its IUPAC name is N-(2-phenylethyl)-N-propan-2-yl-1-[4-[2-(trifluoromethyl)cyclopentyl]phenyl]pentan-3-amine.
| Compound Name | N-(2-phenylethyl)-N-propan-2-yl-1-[4-[2-(trifluoromethyl)cyclopentyl]phenyl]pentan-3-amine |
|---|---|
| PubChem CID | 70244106 |
| Molecular Formula | C28H38F3N |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.30 |
| IUPAC Name | N-(2-phenylethyl)-N-propan-2-yl-1-[4-[2-(trifluoromethyl)cyclopentyl]phenyl]pentan-3-amine |
| SMILES | CCC(CCc1ccc(C2CCCC2C(F)(F)F)cc1)N(CCc1ccccc1)C(C)C |
| InChI | InChI=1S/C28H38F3N/c1-4-25(32(21(2)3)20-19-22-9-6-5-7-10-22)18-15-23-13-16-24(17-14-23)26-11-8-12-27(26)28(29,30)31/h5-7,9-10,13-14,16-17,21,25-27H,4,8,11-12,15,18-20H2,1-3H3 |
| InChIKey | BLYQVJUGAYUNNR-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |