C29H38Cl2N2 — CID 70241659
acetonitrile;4-[2,6-bis(1-chlorocyclopropyl)phenyl]-N-(2-phenylethyl)-N-propan-2-ylbutan-2-amine (PubChem CID 70241659) has the molecular formula C29H38Cl2N2 and a molecular weight of 485.54 g/mol. Its IUPAC name is acetonitrile;4-[2,6-bis(1-chlorocyclopropyl)phenyl]-N-(2-phenylethyl)-N-propan-2-ylbutan-2-amine.
| Compound Name | acetonitrile;4-[2,6-bis(1-chlorocyclopropyl)phenyl]-N-(2-phenylethyl)-N-propan-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 70241659 |
| Molecular Formula | C29H38Cl2N2 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | acetonitrile;4-[2,6-bis(1-chlorocyclopropyl)phenyl]-N-(2-phenylethyl)-N-propan-2-ylbutan-2-amine |
| SMILES | CC#N.CC(C)N(CCc1ccccc1)C(C)CCc1c(C2(Cl)CC2)cccc1C1(Cl)CC1 |
| InChI | InChI=1S/C27H35Cl2N.C2H3N/c1-20(2)30(19-14-22-8-5-4-6-9-22)21(3)12-13-23-24(26(28)15-16-26)10-7-11-25(23)27(29)17-18-27;1-2-3/h4-11,20-21H,12-19H2,1-3H3;1H3 |
| InChIKey | YEBMQMFMYLCSJE-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|