C29H39Cl2N — CID 70243099
4-[2,6-bis(1-chlorocyclobutyl)phenyl]-N-(2-phenylethyl)-N-propan-2-ylbutan-2-amine (PubChem CID 70243099) has the molecular formula C29H39Cl2N and a molecular weight of 472.54 g/mol. Its IUPAC name is 4-[2,6-bis(1-chlorocyclobutyl)phenyl]-N-(2-phenylethyl)-N-propan-2-ylbutan-2-amine.
| Compound Name | 4-[2,6-bis(1-chlorocyclobutyl)phenyl]-N-(2-phenylethyl)-N-propan-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 70243099 |
| Molecular Formula | C29H39Cl2N |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 4-[2,6-bis(1-chlorocyclobutyl)phenyl]-N-(2-phenylethyl)-N-propan-2-ylbutan-2-amine |
| SMILES | CC(C)N(CCc1ccccc1)C(C)CCc1c(C2(Cl)CCC2)cccc1C1(Cl)CCC1 |
| InChI | InChI=1S/C29H39Cl2N/c1-22(2)32(21-16-24-10-5-4-6-11-24)23(3)14-15-25-26(28(30)17-8-18-28)12-7-13-27(25)29(31)19-9-20-29/h4-7,10-13,22-23H,8-9,14-21H2,1-3H3 |
| InChIKey | BCCBIRQYFPNJGT-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|