C27H34Cl2N2 — CID 70241698
acetonitrile;N-benzyl-3-[2,6-bis(1-chlorocyclopropyl)phenyl]-N-propan-2-ylpropan-1-amine (PubChem CID 70241698) has the molecular formula C27H34Cl2N2 and a molecular weight of 457.49 g/mol. Its IUPAC name is acetonitrile;N-benzyl-3-[2,6-bis(1-chlorocyclopropyl)phenyl]-N-propan-2-ylpropan-1-amine.
| Compound Name | acetonitrile;N-benzyl-3-[2,6-bis(1-chlorocyclopropyl)phenyl]-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 70241698 |
| Molecular Formula | C27H34Cl2N2 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | acetonitrile;N-benzyl-3-[2,6-bis(1-chlorocyclopropyl)phenyl]-N-propan-2-ylpropan-1-amine |
| SMILES | CC#N.CC(C)N(CCCc1c(C2(Cl)CC2)cccc1C1(Cl)CC1)Cc1ccccc1 |
| InChI | InChI=1S/C25H31Cl2N.C2H3N/c1-19(2)28(18-20-8-4-3-5-9-20)17-7-10-21-22(24(26)13-14-24)11-6-12-23(21)25(27)15-16-25;1-2-3/h3-6,8-9,11-12,19H,7,10,13-18H2,1-2H3;1H3 |
| InChIKey | DNYZVAAIOAGVSP-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|