C31H42Br2N2 — CID 70241353
acetonitrile;N-benzyl-3-[2,6-bis(1-bromocyclopentyl)phenyl]-N-propylpropan-1-amine (PubChem CID 70241353) has the molecular formula C31H42Br2N2 and a molecular weight of 602.50 g/mol. Its IUPAC name is acetonitrile;N-benzyl-3-[2,6-bis(1-bromocyclopentyl)phenyl]-N-propylpropan-1-amine.
| Compound Name | acetonitrile;N-benzyl-3-[2,6-bis(1-bromocyclopentyl)phenyl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 70241353 |
| Molecular Formula | C31H42Br2N2 |
| Molecular Weight | 602.50 g/mol |
| Exact Mass | 600.17 |
| IUPAC Name | acetonitrile;N-benzyl-3-[2,6-bis(1-bromocyclopentyl)phenyl]-N-propylpropan-1-amine |
| SMILES | CC#N.CCCN(CCCc1c(C2(Br)CCCC2)cccc1C1(Br)CCCC1)Cc1ccccc1 |
| InChI | InChI=1S/C29H39Br2N.C2H3N/c1-2-21-32(23-24-12-4-3-5-13-24)22-11-14-25-26(28(30)17-6-7-18-28)15-10-16-27(25)29(31)19-8-9-20-29;1-2-3/h3-5,10,12-13,15-16H,2,6-9,11,14,17-23H2,1H3;1H3 |
| InChIKey | FDYSECPKJAXVBO-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.50 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|