C25H31Cl2N — CID 70243808
N-benzyl-3-[3,4-bis(1-chlorocyclopropyl)phenyl]-N-propylpropan-1-amine (PubChem CID 70243808) has the molecular formula C25H31Cl2N and a molecular weight of 416.44 g/mol. Its IUPAC name is N-benzyl-3-[3,4-bis(1-chlorocyclopropyl)phenyl]-N-propylpropan-1-amine.
| Compound Name | N-benzyl-3-[3,4-bis(1-chlorocyclopropyl)phenyl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 70243808 |
| Molecular Formula | C25H31Cl2N |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | N-benzyl-3-[3,4-bis(1-chlorocyclopropyl)phenyl]-N-propylpropan-1-amine |
| SMILES | CCCN(CCCc1ccc(C2(Cl)CC2)c(C2(Cl)CC2)c1)Cc1ccccc1 |
| InChI | InChI=1S/C25H31Cl2N/c1-2-16-28(19-21-7-4-3-5-8-21)17-6-9-20-10-11-22(24(26)12-13-24)23(18-20)25(27)14-15-25/h3-5,7-8,10-11,18H,2,6,9,12-17,19H2,1H3 |
| InChIKey | HXZUGBSFHZEKSZ-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|