About N-benzyl-3-[3,4-bis(1-chlorocyclopropyl)phenyl]-N-propan-2-ylpropan-1-amine
N-benzyl-3-[3,4-bis(1-chlorocyclopropyl)phenyl]-N-propan-2-ylpropan-1-amine (PubChem CID 70243319) has the molecular formula C25H31Cl2N
and a molecular weight of 416.44 g/mol. Its IUPAC name is N-benzyl-3-[3,4-bis(1-chlorocyclopropyl)phenyl]-N-propan-2-ylpropan-1-amine.
Molecular Properties
| Compound Name | N-benzyl-3-[3,4-bis(1-chlorocyclopropyl)phenyl]-N-propan-2-ylpropan-1-amine |
| PubChem CID | 70243319 |
| Molecular Formula | C25H31Cl2N |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | N-benzyl-3-[3,4-bis(1-chlorocyclopropyl)phenyl]-N-propan-2-ylpropan-1-amine |
| SMILES | CC(C)N(CCCc1ccc(C2(Cl)CC2)c(C2(Cl)CC2)c1)Cc1ccccc1 |
| InChI | InChI=1S/C25H31Cl2N/c1-19(2)28(18-21-7-4-3-5-8-21)16-6-9-20-10-11-22(24(26)12-13-24)23(17-20)25(27)14-15-25/h3-5,7-8,10-11,17,19H,6,9,12-16,18H2,1-2H3 |
| InChIKey | PFEIMPQAMCQTHE-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-3-[3,4-bis(1-chlorocyclopropyl)phenyl]-N-propan-2-ylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-3-[3,4-bis(1-chlorocyclopropyl)phenyl]-N-propan-2-ylpropan-1-amine?
The IUPAC name of N-benzyl-3-[3,4-bis(1-chlorocyclopropyl)phenyl]-N-propan-2-ylpropan-1-amine (CID 70243319) is N-benzyl-3-[3,4-bis(1-chlorocyclopropyl)phenyl]-N-propan-2-ylpropan-1-amine.
What is the SMILES notation for N-benzyl-3-[3,4-bis(1-chlorocyclopropyl)phenyl]-N-propan-2-ylpropan-1-amine?
The canonical SMILES for N-benzyl-3-[3,4-bis(1-chlorocyclopropyl)phenyl]-N-propan-2-ylpropan-1-amine is CC(C)N(CCCc1ccc(C2(Cl)CC2)c(C2(Cl)CC2)c1)Cc1ccccc1.
What is the InChIKey of N-benzyl-3-[3,4-bis(1-chlorocyclopropyl)phenyl]-N-propan-2-ylpropan-1-amine?
The InChIKey is PFEIMPQAMCQTHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H31Cl2N/c1-19(2)28(18-21-7-4-3-5-8-21)16-6-9-20-10-11-22(24(26)12-13-24)23(17-20)25(27)14-15-25/h3-5,7-8,10-11,17,19H,6,9,12-16,18H2,1-2H3.
What are the key properties of N-benzyl-3-[3,4-bis(1-chlorocyclopropyl)phenyl]-N-propan-2-ylpropan-1-amine?
N-benzyl-3-[3,4-bis(1-chlorocyclopropyl)phenyl]-N-propan-2-ylpropan-1-amine has a molecular weight of 416.44 g/mol, XLogP of 6.99, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-3-[3,4-bis(1-chlorocyclopropyl)phenyl]-N-propan-2-ylpropan-1-amine is sourced from PubChem (CID 70243319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).