C28H30ClNO — CID 57004342
9-[4-[benzyl(propan-2-yl)amino]butyl]fluorene-9-carbonyl chloride (PubChem CID 57004342) has the molecular formula C28H30ClNO and a molecular weight of 432.01 g/mol. Its IUPAC name is 9-[4-[benzyl(propan-2-yl)amino]butyl]fluorene-9-carbonyl chloride.
| Compound Name | 9-[4-[benzyl(propan-2-yl)amino]butyl]fluorene-9-carbonyl chloride |
|---|---|
| PubChem CID | 57004342 |
| Molecular Formula | C28H30ClNO |
| Molecular Weight | 432.01 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 9-[4-[benzyl(propan-2-yl)amino]butyl]fluorene-9-carbonyl chloride |
| SMILES | CC(C)N(CCCCC1(C(=O)Cl)c2ccccc2-c2ccccc21)Cc1ccccc1 |
| InChI | InChI=1S/C28H30ClNO/c1-21(2)30(20-22-12-4-3-5-13-22)19-11-10-18-28(27(29)31)25-16-8-6-14-23(25)24-15-7-9-17-26(24)28/h3-9,12-17,21H,10-11,18-20H2,1-2H3 |
| InChIKey | UWMIVJZXLPSZRW-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.01 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|