C28H38Cl2N2 — CID 70239066
acetonitrile;1-[4-(2,3-dichlorocyclobutyl)phenyl]-N-(2-phenylethyl)-N-propylpentan-3-amine (PubChem CID 70239066) has the molecular formula C28H38Cl2N2 and a molecular weight of 473.53 g/mol. Its IUPAC name is acetonitrile;1-[4-(2,3-dichlorocyclobutyl)phenyl]-N-(2-phenylethyl)-N-propylpentan-3-amine.
| Compound Name | acetonitrile;1-[4-(2,3-dichlorocyclobutyl)phenyl]-N-(2-phenylethyl)-N-propylpentan-3-amine |
|---|---|
| PubChem CID | 70239066 |
| Molecular Formula | C28H38Cl2N2 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | acetonitrile;1-[4-(2,3-dichlorocyclobutyl)phenyl]-N-(2-phenylethyl)-N-propylpentan-3-amine |
| SMILES | CC#N.CCCN(CCc1ccccc1)C(CC)CCc1ccc(C2CC(Cl)C2Cl)cc1 |
| InChI | InChI=1S/C26H35Cl2N.C2H3N/c1-3-17-29(18-16-20-8-6-5-7-9-20)23(4-2)15-12-21-10-13-22(14-11-21)24-19-25(27)26(24)28;1-2-3/h5-11,13-14,23-26H,3-4,12,15-19H2,1-2H3;1H3 |
| InChIKey | OJPLDDBZJRAJJD-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|