About acetonitrile;N-benzyl-4-[4-(2,6-dichlorocyclohexyl)phenyl]-N-methylbutan-2-amine
acetonitrile;N-benzyl-4-[4-(2,6-dichlorocyclohexyl)phenyl]-N-methylbutan-2-amine (PubChem CID 70241896) has the molecular formula C26H34Cl2N2
and a molecular weight of 445.48 g/mol. Its IUPAC name is acetonitrile;N-benzyl-4-[4-(2,6-dichlorocyclohexyl)phenyl]-N-methylbutan-2-amine.
Molecular Properties
| Compound Name | acetonitrile;N-benzyl-4-[4-(2,6-dichlorocyclohexyl)phenyl]-N-methylbutan-2-amine |
| PubChem CID | 70241896 |
| Molecular Formula | C26H34Cl2N2 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | acetonitrile;N-benzyl-4-[4-(2,6-dichlorocyclohexyl)phenyl]-N-methylbutan-2-amine |
| SMILES | CC#N.CC(CCc1ccc(C2C(Cl)CCCC2Cl)cc1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C24H31Cl2N.C2H3N/c1-18(27(2)17-20-7-4-3-5-8-20)11-12-19-13-15-21(16-14-19)24-22(25)9-6-10-23(24)26;1-2-3/h3-5,7-8,13-16,18,22-24H,6,9-12,17H2,1-2H3;1H3 |
| InChIKey | CDUYLBANJQXRPI-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;N-benzyl-4-[4-(2,6-dichlorocyclohexyl)phenyl]-N-methylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;N-benzyl-4-[4-(2,6-dichlorocyclohexyl)phenyl]-N-methylbutan-2-amine?
The IUPAC name of acetonitrile;N-benzyl-4-[4-(2,6-dichlorocyclohexyl)phenyl]-N-methylbutan-2-amine (CID 70241896) is acetonitrile;N-benzyl-4-[4-(2,6-dichlorocyclohexyl)phenyl]-N-methylbutan-2-amine.
What is the SMILES notation for acetonitrile;N-benzyl-4-[4-(2,6-dichlorocyclohexyl)phenyl]-N-methylbutan-2-amine?
The canonical SMILES for acetonitrile;N-benzyl-4-[4-(2,6-dichlorocyclohexyl)phenyl]-N-methylbutan-2-amine is CC#N.CC(CCc1ccc(C2C(Cl)CCCC2Cl)cc1)N(C)Cc1ccccc1.
What is the InChIKey of acetonitrile;N-benzyl-4-[4-(2,6-dichlorocyclohexyl)phenyl]-N-methylbutan-2-amine?
The InChIKey is CDUYLBANJQXRPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31Cl2N.C2H3N/c1-18(27(2)17-20-7-4-3-5-8-20)11-12-19-13-15-21(16-14-19)24-22(25)9-6-10-23(24)26;1-2-3/h3-5,7-8,13-16,18,22-24H,6,9-12,17H2,1-2H3;1H3.
What are the key properties of acetonitrile;N-benzyl-4-[4-(2,6-dichlorocyclohexyl)phenyl]-N-methylbutan-2-amine?
acetonitrile;N-benzyl-4-[4-(2,6-dichlorocyclohexyl)phenyl]-N-methylbutan-2-amine has a molecular weight of 445.48 g/mol, XLogP of 7.15, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;N-benzyl-4-[4-(2,6-dichlorocyclohexyl)phenyl]-N-methylbutan-2-amine is sourced from PubChem (CID 70241896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).