C26H34Cl2N2 — CID 70241896
acetonitrile;N-benzyl-4-[4-(2,6-dichlorocyclohexyl)phenyl]-N-methylbutan-2-amine (PubChem CID 70241896) has the molecular formula C26H34Cl2N2 and a molecular weight of 445.48 g/mol. Its IUPAC name is acetonitrile;N-benzyl-4-[4-(2,6-dichlorocyclohexyl)phenyl]-N-methylbutan-2-amine.
| Compound Name | acetonitrile;N-benzyl-4-[4-(2,6-dichlorocyclohexyl)phenyl]-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 70241896 |
| Molecular Formula | C26H34Cl2N2 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | acetonitrile;N-benzyl-4-[4-(2,6-dichlorocyclohexyl)phenyl]-N-methylbutan-2-amine |
| SMILES | CC#N.CC(CCc1ccc(C2C(Cl)CCCC2Cl)cc1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C24H31Cl2N.C2H3N/c1-18(27(2)17-20-7-4-3-5-8-20)11-12-19-13-15-21(16-14-19)24-22(25)9-6-10-23(24)26;1-2-3/h3-5,7-8,13-16,18,22-24H,6,9-12,17H2,1-2H3;1H3 |
| InChIKey | CDUYLBANJQXRPI-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|