C5H8O2 — CID 70241770
3-methyl-2,5-dihydrofuran-2-ol (PubChem CID 70241770) has the molecular formula C5H8O2 and a molecular weight of 100.12 g/mol. Its IUPAC name is 3-methyl-2,5-dihydrofuran-2-ol.
| Compound Name | 3-methyl-2,5-dihydrofuran-2-ol |
|---|---|
| PubChem CID | 70241770 |
| Molecular Formula | C5H8O2 |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.05 |
| IUPAC Name | 3-methyl-2,5-dihydrofuran-2-ol |
| SMILES | CC1=CCOC1O |
| InChI | InChI=1S/C5H8O2/c1-4-2-3-7-5(4)6/h2,5-6H,3H2,1H3 |
| InChIKey | BLDYRXBZKMGKAU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|