C25H30N2O3 — CID 70242410
1-[(2S)-3-(3,4-dimethylphenoxy)-2-hydroxypropyl]-4-quinolin-3-ylpiperidin-4-ol (PubChem CID 70242410) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-[(2S)-3-(3,4-dimethylphenoxy)-2-hydroxypropyl]-4-quinolin-3-ylpiperidin-4-ol.
| Compound Name | 1-[(2S)-3-(3,4-dimethylphenoxy)-2-hydroxypropyl]-4-quinolin-3-ylpiperidin-4-ol |
|---|---|
| PubChem CID | 70242410 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 1-[(2S)-3-(3,4-dimethylphenoxy)-2-hydroxypropyl]-4-quinolin-3-ylpiperidin-4-ol |
| SMILES | Cc1ccc(OC[C@@H](O)CN2CCC(O)(c3cnc4ccccc4c3)CC2)cc1C |
| InChI | InChI=1S/C25H30N2O3/c1-18-7-8-23(13-19(18)2)30-17-22(28)16-27-11-9-25(29,10-12-27)21-14-20-5-3-4-6-24(20)26-15-21/h3-8,13-15,22,28-29H,9-12,16-17H2,1-2H3/t22-/m0/s1 |
| InChIKey | LZORCQHRPNQSKM-QFIPXVFZSA-N |
| XLogP | 3.57 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |