C24H28N2O4 — CID 56981117
1-[3-hydroxy-3-(3-methoxyphenoxy)propyl]-4-quinolin-3-ylpiperidin-4-ol (PubChem CID 56981117) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is 1-[3-hydroxy-3-(3-methoxyphenoxy)propyl]-4-quinolin-3-ylpiperidin-4-ol.
| Compound Name | 1-[3-hydroxy-3-(3-methoxyphenoxy)propyl]-4-quinolin-3-ylpiperidin-4-ol |
|---|---|
| PubChem CID | 56981117 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 1-[3-hydroxy-3-(3-methoxyphenoxy)propyl]-4-quinolin-3-ylpiperidin-4-ol |
| SMILES | COc1cccc(OC(O)CCN2CCC(O)(c3cnc4ccccc4c3)CC2)c1 |
| InChI | InChI=1S/C24H28N2O4/c1-29-20-6-4-7-21(16-20)30-23(27)9-12-26-13-10-24(28,11-14-26)19-15-18-5-2-3-8-22(18)25-17-19/h2-8,15-17,23,27-28H,9-14H2,1H3 |
| InChIKey | DLSDMKMMDVWSIK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 75.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|