C26H29N3O3 — CID 57168911
1-[3-hydroxy-3-(1-methylindol-4-yl)oxypropyl]-4-quinolin-3-ylpiperidin-4-ol (PubChem CID 57168911) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is 1-[3-hydroxy-3-(1-methylindol-4-yl)oxypropyl]-4-quinolin-3-ylpiperidin-4-ol.
| Compound Name | 1-[3-hydroxy-3-(1-methylindol-4-yl)oxypropyl]-4-quinolin-3-ylpiperidin-4-ol |
|---|---|
| PubChem CID | 57168911 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 1-[3-hydroxy-3-(1-methylindol-4-yl)oxypropyl]-4-quinolin-3-ylpiperidin-4-ol |
| SMILES | Cn1ccc2c(OC(O)CCN3CCC(O)(c4cnc5ccccc5c4)CC3)cccc21 |
| InChI | InChI=1S/C26H29N3O3/c1-28-13-9-21-23(28)7-4-8-24(21)32-25(30)10-14-29-15-11-26(31,12-16-29)20-17-19-5-2-3-6-22(19)27-18-20/h2-9,13,17-18,25,30-31H,10-12,14-16H2,1H3 |
| InChIKey | CIEPUPCBCJJNSE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|