C21H26FN — CID 70243797
3-[4-(2-fluorocyclopropyl)phenyl]-N-methyl-N-(2-phenylethyl)propan-1-amine (PubChem CID 70243797) has the molecular formula C21H26FN and a molecular weight of 311.44 g/mol. Its IUPAC name is 3-[4-(2-fluorocyclopropyl)phenyl]-N-methyl-N-(2-phenylethyl)propan-1-amine.
| Compound Name | 3-[4-(2-fluorocyclopropyl)phenyl]-N-methyl-N-(2-phenylethyl)propan-1-amine |
|---|---|
| PubChem CID | 70243797 |
| Molecular Formula | C21H26FN |
| Molecular Weight | 311.44 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 3-[4-(2-fluorocyclopropyl)phenyl]-N-methyl-N-(2-phenylethyl)propan-1-amine |
| SMILES | CN(CCCc1ccc(C2CC2F)cc1)CCc1ccccc1 |
| InChI | InChI=1S/C21H26FN/c1-23(15-13-17-6-3-2-4-7-17)14-5-8-18-9-11-19(12-10-18)20-16-21(20)22/h2-4,6-7,9-12,20-21H,5,8,13-16H2,1H3 |
| InChIKey | LFLYJPYHMIWFKO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |