C21H26BrN — CID 70243904
3-[4-(2-bromocyclopropyl)phenyl]-N-methyl-N-(2-phenylethyl)propan-1-amine (PubChem CID 70243904) has the molecular formula C21H26BrN and a molecular weight of 372.35 g/mol. Its IUPAC name is 3-[4-(2-bromocyclopropyl)phenyl]-N-methyl-N-(2-phenylethyl)propan-1-amine.
| Compound Name | 3-[4-(2-bromocyclopropyl)phenyl]-N-methyl-N-(2-phenylethyl)propan-1-amine |
|---|---|
| PubChem CID | 70243904 |
| Molecular Formula | C21H26BrN |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 3-[4-(2-bromocyclopropyl)phenyl]-N-methyl-N-(2-phenylethyl)propan-1-amine |
| SMILES | CN(CCCc1ccc(C2CC2Br)cc1)CCc1ccccc1 |
| InChI | InChI=1S/C21H26BrN/c1-23(15-13-17-6-3-2-4-7-17)14-5-8-18-9-11-19(12-10-18)20-16-21(20)22/h2-4,6-7,9-12,20-21H,5,8,13-16H2,1H3 |
| InChIKey | LUAWAIURDFLCKC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|