C19H22N4O2S — CID 7024444
2-[2-[[(2S)-2-hydroxypropyl]amino]benzimidazol-1-yl]-N-(2-methylsulfanylphenyl)acetamide (PubChem CID 7024444) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is 2-[2-[[(2S)-2-hydroxypropyl]amino]benzimidazol-1-yl]-N-(2-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[2-[[(2S)-2-hydroxypropyl]amino]benzimidazol-1-yl]-N-(2-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 7024444 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-[2-[[(2S)-2-hydroxypropyl]amino]benzimidazol-1-yl]-N-(2-methylsulfanylphenyl)acetamide |
| SMILES | CSc1ccccc1NC(=O)Cn1c(NC[C@H](C)O)nc2ccccc21 |
| InChI | InChI=1S/C19H22N4O2S/c1-13(24)11-20-19-22-14-7-3-5-9-16(14)23(19)12-18(25)21-15-8-4-6-10-17(15)26-2/h3-10,13,24H,11-12H2,1-2H3,(H,20,22)(H,21,25)/t13-/m0/s1 |
| InChIKey | REYZGOGHHBFIGG-ZDUSSCGKSA-N |
| XLogP | 3.19 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |