C40H52ClN5O6 — CID 70245463
2-[[1-[4-[3-(diethylamino)propanoylamino]-5,6,7,8-tetrahydronaphthalen-1-yl]-5-(2,6-dimethoxyphenyl)pyrazole-3-carbonyl]amino]adamantane-2-carboxylic acid;hydrochloride (PubChem CID 70245463) has the molecular formula C40H52ClN5O6 and a molecular weight of 734.34 g/mol. Its IUPAC name is 2-[[1-[4-[3-(diethylamino)propanoylamino]-5,6,7,8-tetrahydronaphthalen-1-yl]-5-(2,6-dimethoxyphenyl)pyrazole-3-carbonyl]amino]adamantane-2-carboxylic acid;hydrochloride.
| Compound Name | 2-[[1-[4-[3-(diethylamino)propanoylamino]-5,6,7,8-tetrahydronaphthalen-1-yl]-5-(2,6-dimethoxyphenyl)pyrazole-3-carbonyl]amino]adamantane-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 70245463 |
| Molecular Formula | C40H52ClN5O6 |
| Molecular Weight | 734.34 g/mol |
| Exact Mass | 733.36 |
| IUPAC Name | 2-[[1-[4-[3-(diethylamino)propanoylamino]-5,6,7,8-tetrahydronaphthalen-1-yl]-5-(2,6-dimethoxyphenyl)pyrazole-3-carbonyl]amino]adamantane-2-carboxylic acid;hydrochloride |
| SMILES | CCN(CC)CCC(=O)Nc1ccc(-n2nc(C(=O)NC3(C(=O)O)C4CC5CC(C4)CC3C5)cc2-c2c(OC)cccc2OC)c2c1CCCC2.Cl |
| InChI | InChI=1S/C40H51N5O6.ClH/c1-5-44(6-2)17-16-36(46)41-30-14-15-32(29-11-8-7-10-28(29)30)45-33(37-34(50-3)12-9-13-35(37)51-4)23-31(43-45)38(47)42-40(39(48)49)26-19-24-18-25(21-26)22-27(40)20-24;/h9,12-15,23-27H,5-8,10-11,16-22H2,1-4H3,(H,41,46)(H,42,47)(H,48,49);1H |
| InChIKey | RPWIJNZNGJCDRC-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.34 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |