C21H29N3O3 — CID 70245476
tert-butyl N-[2-(4-aminophenyl)ethyl]-N-[2-hydroxy-2-(2-methyl-3-pyridinyl)ethyl]carbamate (PubChem CID 70245476) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is tert-butyl N-[2-(4-aminophenyl)ethyl]-N-[2-hydroxy-2-(2-methyl-3-pyridinyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-aminophenyl)ethyl]-N-[2-hydroxy-2-(2-methyl-3-pyridinyl)ethyl]carbamate |
|---|---|
| PubChem CID | 70245476 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | tert-butyl N-[2-(4-aminophenyl)ethyl]-N-[2-hydroxy-2-(2-methyl-3-pyridinyl)ethyl]carbamate |
| SMILES | Cc1ncccc1C(O)CN(CCc1ccc(N)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H29N3O3/c1-15-18(6-5-12-23-15)19(25)14-24(20(26)27-21(2,3)4)13-11-16-7-9-17(22)10-8-16/h5-10,12,19,25H,11,13-14,22H2,1-4H3 |
| InChIKey | AGPISWNORHMCCJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|