About morpholin-4-yl 4-(2-chloro-4-fluorophenyl)-2-morpholin-4-ylpyrimidine-5-carboxylate
morpholin-4-yl 4-(2-chloro-4-fluorophenyl)-2-morpholin-4-ylpyrimidine-5-carboxylate (PubChem CID 70247994) has the molecular formula C19H20ClFN4O4
and a molecular weight of 422.84 g/mol. Its IUPAC name is morpholin-4-yl 4-(2-chloro-4-fluorophenyl)-2-morpholin-4-ylpyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | morpholin-4-yl 4-(2-chloro-4-fluorophenyl)-2-morpholin-4-ylpyrimidine-5-carboxylate |
| PubChem CID | 70247994 |
| Molecular Formula | C19H20ClFN4O4 |
| Molecular Weight | 422.84 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | morpholin-4-yl 4-(2-chloro-4-fluorophenyl)-2-morpholin-4-ylpyrimidine-5-carboxylate |
| SMILES | O=C(ON1CCOCC1)c1cnc(N2CCOCC2)nc1-c1ccc(F)cc1Cl |
| InChI | InChI=1S/C19H20ClFN4O4/c20-16-11-13(21)1-2-14(16)17-15(18(26)29-25-5-9-28-10-6-25)12-22-19(23-17)24-3-7-27-8-4-24/h1-2,11-12H,3-10H2 |
| InChIKey | LZSKHCSBSTVTOG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.84 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze morpholin-4-yl 4-(2-chloro-4-fluorophenyl)-2-morpholin-4-ylpyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-4-yl 4-(2-chloro-4-fluorophenyl)-2-morpholin-4-ylpyrimidine-5-carboxylate?
The IUPAC name of morpholin-4-yl 4-(2-chloro-4-fluorophenyl)-2-morpholin-4-ylpyrimidine-5-carboxylate (CID 70247994) is morpholin-4-yl 4-(2-chloro-4-fluorophenyl)-2-morpholin-4-ylpyrimidine-5-carboxylate.
What is the SMILES notation for morpholin-4-yl 4-(2-chloro-4-fluorophenyl)-2-morpholin-4-ylpyrimidine-5-carboxylate?
The canonical SMILES for morpholin-4-yl 4-(2-chloro-4-fluorophenyl)-2-morpholin-4-ylpyrimidine-5-carboxylate is O=C(ON1CCOCC1)c1cnc(N2CCOCC2)nc1-c1ccc(F)cc1Cl.
What is the InChIKey of morpholin-4-yl 4-(2-chloro-4-fluorophenyl)-2-morpholin-4-ylpyrimidine-5-carboxylate?
The InChIKey is LZSKHCSBSTVTOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20ClFN4O4/c20-16-11-13(21)1-2-14(16)17-15(18(26)29-25-5-9-28-10-6-25)12-22-19(23-17)24-3-7-27-8-4-24/h1-2,11-12H,3-10H2.
What are the key properties of morpholin-4-yl 4-(2-chloro-4-fluorophenyl)-2-morpholin-4-ylpyrimidine-5-carboxylate?
morpholin-4-yl 4-(2-chloro-4-fluorophenyl)-2-morpholin-4-ylpyrimidine-5-carboxylate has a molecular weight of 422.84 g/mol, XLogP of 2.18, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-4-yl 4-(2-chloro-4-fluorophenyl)-2-morpholin-4-ylpyrimidine-5-carboxylate is sourced from PubChem (CID 70247994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).