C12H15F3N2O4S — CID 70248088
ethyl 2-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)acetate;2,2,2-trifluoroacetic acid (PubChem CID 70248088) has the molecular formula C12H15F3N2O4S and a molecular weight of 340.32 g/mol. Its IUPAC name is ethyl 2-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)acetate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 2-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70248088 |
| Molecular Formula | C12H15F3N2O4S |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | ethyl 2-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)acetate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)Cc1nc2c(s1)CNCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H14N2O2S.C2HF3O2/c1-2-14-10(13)5-9-12-7-3-4-11-6-8(7)15-9;3-2(4,5)1(6)7/h11H,2-6H2,1H3;(H,6,7) |
| InChIKey | ZDOALVZRUSJYGT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |