C25H37BrO3 — CID 70249259
1-[(8R,9S,10S,13S,14S,17S)-2-bromo-3-hydroxy-3-(4-hydroxybut-2-ynyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 70249259) has the molecular formula C25H37BrO3 and a molecular weight of 465.47 g/mol. Its IUPAC name is 1-[(8R,9S,10S,13S,14S,17S)-2-bromo-3-hydroxy-3-(4-hydroxybut-2-ynyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(8R,9S,10S,13S,14S,17S)-2-bromo-3-hydroxy-3-(4-hydroxybut-2-ynyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 70249259 |
| Molecular Formula | C25H37BrO3 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 1-[(8R,9S,10S,13S,14S,17S)-2-bromo-3-hydroxy-3-(4-hydroxybut-2-ynyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4CC(O)(CC#CCO)C(Br)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H37BrO3/c1-16(28)19-8-9-20-18-7-6-17-14-25(29,11-4-5-13-27)22(26)15-24(17,3)21(18)10-12-23(19,20)2/h17-22,27,29H,6-15H2,1-3H3/t17?,18-,19+,20-,21-,22?,23+,24-,25?/m0/s1 |
| InChIKey | BPRPPARHBDXPSN-ZAJPRXBVSA-N |
| XLogP | 4.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|