C30H38FNO4 — CID 70255980
[(2,3-dimethoxyphenyl)-[1-[2-(4-fluorophenyl)ethyl]-2H-pyridin-4-yl]methyl] octanoate (PubChem CID 70255980) has the molecular formula C30H38FNO4 and a molecular weight of 495.64 g/mol. Its IUPAC name is [(2,3-dimethoxyphenyl)-[1-[2-(4-fluorophenyl)ethyl]-2H-pyridin-4-yl]methyl] octanoate.
| Compound Name | [(2,3-dimethoxyphenyl)-[1-[2-(4-fluorophenyl)ethyl]-2H-pyridin-4-yl]methyl] octanoate |
|---|---|
| PubChem CID | 70255980 |
| Molecular Formula | C30H38FNO4 |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | [(2,3-dimethoxyphenyl)-[1-[2-(4-fluorophenyl)ethyl]-2H-pyridin-4-yl]methyl] octanoate |
| SMILES | CCCCCCCC(=O)OC(C1=CCN(CCc2ccc(F)cc2)C=C1)c1cccc(OC)c1OC |
| InChI | InChI=1S/C30H38FNO4/c1-4-5-6-7-8-12-28(33)36-29(26-10-9-11-27(34-2)30(26)35-3)24-18-21-32(22-19-24)20-17-23-13-15-25(31)16-14-23/h9-11,13-16,18-19,21,29H,4-8,12,17,20,22H2,1-3H3 |
| InChIKey | FRNKGXPIZQIXCW-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|