C25H27F3N4O2 — CID 70256794
2-[3-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-2-methylidenepiperidin-1-yl]-2-(3,4,5-trifluorophenyl)ethanol (PubChem CID 70256794) has the molecular formula C25H27F3N4O2 and a molecular weight of 472.51 g/mol. Its IUPAC name is 2-[3-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-2-methylidenepiperidin-1-yl]-2-(3,4,5-trifluorophenyl)ethanol.
| Compound Name | 2-[3-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-2-methylidenepiperidin-1-yl]-2-(3,4,5-trifluorophenyl)ethanol |
|---|---|
| PubChem CID | 70256794 |
| Molecular Formula | C25H27F3N4O2 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 2-[3-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-2-methylidenepiperidin-1-yl]-2-(3,4,5-trifluorophenyl)ethanol |
| SMILES | C=C1C(Nc2ccc(-n3cnc(C)c3)c(OC)c2)CCCN1C(CO)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C25H27F3N4O2/c1-15-12-31(14-29-15)22-7-6-18(11-24(22)34-3)30-21-5-4-8-32(16(21)2)23(13-33)17-9-19(26)25(28)20(27)10-17/h6-7,9-12,14,21,23,30,33H,2,4-5,8,13H2,1,3H3 |
| InChIKey | ZUCSLVTWGGQENL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|