C23H20F3N5O3 — CID 46216604
methyl 3-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-1-[(3,4,5-trifluorophenyl)methyl]pyrazole-5-carboxylate (PubChem CID 46216604) has the molecular formula C23H20F3N5O3 and a molecular weight of 471.44 g/mol. Its IUPAC name is methyl 3-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-1-[(3,4,5-trifluorophenyl)methyl]pyrazole-5-carboxylate.
| Compound Name | methyl 3-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-1-[(3,4,5-trifluorophenyl)methyl]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 46216604 |
| Molecular Formula | C23H20F3N5O3 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | methyl 3-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-1-[(3,4,5-trifluorophenyl)methyl]pyrazole-5-carboxylate |
| SMILES | COC(=O)c1cc(Nc2ccc(-n3cnc(C)c3)c(OC)c2)nn1Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C23H20F3N5O3/c1-13-10-30(12-27-13)18-5-4-15(8-20(18)33-2)28-21-9-19(23(32)34-3)31(29-21)11-14-6-16(24)22(26)17(25)7-14/h4-10,12H,11H2,1-3H3,(H,28,29) |
| InChIKey | PASLJKQNLUOBRM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|