C23H22F3N5O3 — CID 143985882
methyl (Z)-4-amino-4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]imino-2-[(3,4,5-trifluorophenyl)methylamino]but-2-enoate (PubChem CID 143985882) has the molecular formula C23H22F3N5O3 and a molecular weight of 473.46 g/mol. Its IUPAC name is methyl (Z)-4-amino-4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]imino-2-[(3,4,5-trifluorophenyl)methylamino]but-2-enoate.
| Compound Name | methyl (Z)-4-amino-4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]imino-2-[(3,4,5-trifluorophenyl)methylamino]but-2-enoate |
|---|---|
| PubChem CID | 143985882 |
| Molecular Formula | C23H22F3N5O3 |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | methyl (Z)-4-amino-4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]imino-2-[(3,4,5-trifluorophenyl)methylamino]but-2-enoate |
| SMILES | COC(=O)/C(=C/C(N)=N/c1ccc(-n2cnc(C)c2)c(OC)c1)NCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C23H22F3N5O3/c1-13-11-31(12-29-13)19-5-4-15(8-20(19)33-2)30-21(27)9-18(23(32)34-3)28-10-14-6-16(24)22(26)17(25)7-14/h4-9,11-12,28H,10H2,1-3H3,(H2,27,30)/b18-9- |
| InChIKey | MIPBHADJUFDTTO-NVMNQCDNSA-N |
| XLogP | 3.44 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|